C87H58N4 — CID 167403537
9-[4-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-bis(4-phenylphenyl)phenyl]-3,6-diphenylcarbazole (PubChem CID 167403537) has the molecular formula C87H58N4 and a molecular weight of 1159.45 g/mol. Its IUPAC name is 9-[4-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-bis(4-phenylphenyl)phenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[4-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-bis(4-phenylphenyl)phenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 167403537 |
| Molecular Formula | C87H58N4 |
| Molecular Weight | 1159.45 g/mol |
| Exact Mass | 1158.47 |
| IUPAC Name | 9-[4-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-bis(4-phenylphenyl)phenyl]-3,6-diphenylcarbazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)nc(-c4cc(-c5ccc(-c6ccccc6)cc5)c(-n5c6ccc(-c7ccccc7)cc6c6cc(-c7ccccc7)ccc65)c(-c5ccc(-c6ccccc6)cc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C87H58N4/c1-8-22-59(23-9-1)66-36-42-69(43-37-66)78-57-77(87-89-85(71-46-40-68(41-47-71)61-26-12-3-13-27-61)88-86(90-87)76-53-74(64-32-18-6-19-33-64)52-75(54-76)65-34-20-7-21-35-65)58-79(70-44-38-67(39-45-70)60-24-10-2-11-25-60)84(78)91-82-50-48-72(62-28-14-4-15-29-62)55-80(82)81-56-73(49-51-83(81)91)63-30-16-5-17-31-63/h1-58H |
| InChIKey | HGSWNGUIKVKIDP-UHFFFAOYSA-N |
| XLogP | 22.97 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 91 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1159.45 |
| LogP ≤ 5 | 22.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |