C57H40N6 — CID 167382094
9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]carbazole-3,6-diamine (PubChem CID 167382094) has the molecular formula C57H40N6 and a molecular weight of 808.99 g/mol. Its IUPAC name is 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]carbazole-3,6-diamine.
| Compound Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]carbazole-3,6-diamine |
|---|---|
| PubChem CID | 167382094 |
| Molecular Formula | C57H40N6 |
| Molecular Weight | 808.99 g/mol |
| Exact Mass | 808.33 |
| IUPAC Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]carbazole-3,6-diamine |
| SMILES | Nc1ccc2c(c1)c1cc(N)ccc1n2-c1c(-c2ccc(-c3ccccc3)cc2)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C57H40N6/c58-46-29-31-52-50(35-46)51-36-47(59)30-32-53(51)63(52)54-48(41-25-21-39(22-26-41)37-13-5-1-6-14-37)33-45(34-49(54)42-27-23-40(24-28-42)38-15-7-2-8-16-38)57-61-55(43-17-9-3-10-18-43)60-56(62-57)44-19-11-4-12-20-44/h1-36H,58-59H2 |
| InChIKey | ODOSJWVQVRKNQG-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.99 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|