C51H44N6 — CID 146281005
3,6-ditert-butyl-9-[4-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]carbazole (PubChem CID 146281005) has the molecular formula C51H44N6 and a molecular weight of 740.96 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]carbazole |
|---|---|
| PubChem CID | 146281005 |
| Molecular Formula | C51H44N6 |
| Molecular Weight | 740.96 g/mol |
| Exact Mass | 740.36 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1c(-c2ccccc2)cc(-c2nc(-c3ccncc3)nc(-c3ccncc3)n2)cc1-c1ccccc1 |
| InChI | InChI=1S/C51H44N6/c1-50(2,3)38-17-19-44-42(31-38)43-32-39(51(4,5)6)18-20-45(43)57(44)46-40(33-13-9-7-10-14-33)29-37(30-41(46)34-15-11-8-12-16-34)49-55-47(35-21-25-52-26-22-35)54-48(56-49)36-23-27-53-28-24-36/h7-32H,1-6H3 |
| InChIKey | RNUSSCCGMFOVFG-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.96 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |