C69H62N4 — CID 146281225
1,3,6-tritert-butyl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]carbazole (PubChem CID 146281225) has the molecular formula C69H62N4 and a molecular weight of 947.28 g/mol. Its IUPAC name is 1,3,6-tritert-butyl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]carbazole.
| Compound Name | 1,3,6-tritert-butyl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]carbazole |
|---|---|
| PubChem CID | 146281225 |
| Molecular Formula | C69H62N4 |
| Molecular Weight | 947.28 g/mol |
| Exact Mass | 946.50 |
| IUPAC Name | 1,3,6-tritert-butyl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1n2-c1c(-c2ccc(-c3ccccc3)cc2)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C69H62N4/c1-67(2,3)54-38-39-61-58(42-54)59-43-55(68(4,5)6)44-60(69(7,8)9)63(59)73(61)62-56(49-34-30-47(31-35-49)45-22-14-10-15-23-45)40-53(41-57(62)50-36-32-48(33-37-50)46-24-16-11-17-25-46)66-71-64(51-26-18-12-19-27-51)70-65(72-66)52-28-20-13-21-29-52/h10-44H,1-9H3 |
| InChIKey | MHICVNLPIJQXRC-UHFFFAOYSA-N |
| XLogP | 18.53 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.28 |
| LogP ≤ 5 | 18.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |