C65H50N4O2 — CID 146281036
3,6-ditert-butyl-9-[4-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]carbazole (PubChem CID 146281036) has the molecular formula C65H50N4O2 and a molecular weight of 919.14 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]carbazole |
|---|---|
| PubChem CID | 146281036 |
| Molecular Formula | C65H50N4O2 |
| Molecular Weight | 919.14 g/mol |
| Exact Mass | 918.39 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1c(-c2ccccc2)cc(-c2nc(-c3ccc4c(c3)oc3ccccc34)nc(-c3ccc4c(c3)oc3ccccc34)n2)cc1-c1ccccc1 |
| InChI | InChI=1S/C65H50N4O2/c1-64(2,3)44-27-31-54-52(37-44)53-38-45(65(4,5)6)28-32-55(53)69(54)60-50(39-17-9-7-10-18-39)33-43(34-51(60)40-19-11-8-12-20-40)63-67-61(41-25-29-48-46-21-13-15-23-56(46)70-58(48)35-41)66-62(68-63)42-26-30-49-47-22-14-16-24-57(47)71-59(49)36-42/h7-38H,1-6H3 |
| InChIKey | LXFAQXBPCKYXSL-UHFFFAOYSA-N |
| XLogP | 17.70 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.14 |
| LogP ≤ 5 | 17.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |