C58H35N5O — CID 153301207
9-[4-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-3-isocyano-6-phenylcarbazole (PubChem CID 153301207) has the molecular formula C58H35N5O and a molecular weight of 817.95 g/mol. Its IUPAC name is 9-[4-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-3-isocyano-6-phenylcarbazole.
| Compound Name | 9-[4-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-3-isocyano-6-phenylcarbazole |
|---|---|
| PubChem CID | 153301207 |
| Molecular Formula | C58H35N5O |
| Molecular Weight | 817.95 g/mol |
| Exact Mass | 817.28 |
| IUPAC Name | 9-[4-(4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-3-isocyano-6-phenylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3ccccc3)ccc1n2-c1c(-c2ccccc2)cc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)oc3ccccc34)n2)cc1-c1ccccc1 |
| InChI | InChI=1S/C58H35N5O/c1-59-44-28-31-52-50(36-44)49-32-41(37-16-6-2-7-17-37)27-30-51(49)63(52)55-47(38-18-8-3-9-19-38)33-43(34-48(55)39-20-10-4-11-21-39)58-61-56(40-22-12-5-13-23-40)60-57(62-58)42-26-29-46-45-24-14-15-25-53(45)64-54(46)35-42/h2-36H |
| InChIKey | YCZAOCPMOSRXSA-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 61.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.95 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|