C58H39N5 — CID 168747943
9-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-3-isocyano-6-phenylcarbazole (PubChem CID 168747943) has the molecular formula C58H39N5 and a molecular weight of 805.98 g/mol. Its IUPAC name is 9-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-3-isocyano-6-phenylcarbazole.
| Compound Name | 9-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-3-isocyano-6-phenylcarbazole |
|---|---|
| PubChem CID | 168747943 |
| Molecular Formula | C58H39N5 |
| Molecular Weight | 805.98 g/mol |
| Exact Mass | 805.32 |
| IUPAC Name | 9-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-3-isocyano-6-phenylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3ccccc3)ccc1n2-c1c(-c2ccccc2)cc(-c2nc(/C(C=C)=C/C=C)nc(-c3ccc(-c4ccccc4)cc3)n2)cc1-c1ccccc1 |
| InChI | InChI=1S/C58H39N5/c1-4-18-39(5-2)56-60-57(45-29-27-42(28-30-45)40-19-10-6-11-20-40)62-58(61-56)47-36-49(43-23-14-8-15-24-43)55(50(37-47)44-25-16-9-17-26-44)63-53-33-31-46(41-21-12-7-13-22-41)35-51(53)52-38-48(59-3)32-34-54(52)63/h4-38H,1-2H2/b39-18+ |
| InChIKey | NEACQWZFHIBPGO-KZEIVMGFSA-N |
| XLogP | 15.28 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.98 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|