C81H56N4 — CID 167401552
9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-6-(4-phenylphenyl)phenyl]-2,4,5,7-tetraphenylcarbazole (PubChem CID 167401552) has the molecular formula C81H56N4 and a molecular weight of 1085.37 g/mol. Its IUPAC name is 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-6-(4-phenylphenyl)phenyl]-2,4,5,7-tetraphenylcarbazole.
| Compound Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-6-(4-phenylphenyl)phenyl]-2,4,5,7-tetraphenylcarbazole |
|---|---|
| PubChem CID | 167401552 |
| Molecular Formula | C81H56N4 |
| Molecular Weight | 1085.37 g/mol |
| Exact Mass | 1084.45 |
| IUPAC Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-6-(4-phenylphenyl)phenyl]-2,4,5,7-tetraphenylcarbazole |
| SMILES | C=C/C=C(\C=C)c1ccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3ccc(-c4ccccc4)cc3)c2-n2c3cc(-c4ccccc4)cc(-c4ccccc4)c3c3c(-c4ccccc4)cc(-c4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C81H56N4/c1-3-26-55(4-2)59-41-45-63(46-42-59)72-51-69(81-83-79(65-37-22-10-23-38-65)82-80(84-81)66-39-24-11-25-40-66)52-73(64-47-43-60(44-48-64)56-27-12-5-13-28-56)78(72)85-74-53-67(57-29-14-6-15-30-57)49-70(61-33-18-8-19-34-61)76(74)77-71(62-35-20-9-21-36-62)50-68(54-75(77)85)58-31-16-7-17-32-58/h3-54H,1-2H2/b55-26+ |
| InChIKey | RTEPEVFEMAFXKP-VHPMDJGMSA-N |
| XLogP | 21.39 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1085.37 |
| LogP ≤ 5 | 21.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|