C62H41N5O — CID 155179848
3-[4-[4-(3,6-diphenylcarbazol-9-yl)-3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[3,2-b]pyridine (PubChem CID 155179848) has the molecular formula C62H41N5O and a molecular weight of 872.04 g/mol. Its IUPAC name is 3-[4-[4-(3,6-diphenylcarbazol-9-yl)-3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[3,2-b]pyridine.
| Compound Name | 3-[4-[4-(3,6-diphenylcarbazol-9-yl)-3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 155179848 |
| Molecular Formula | C62H41N5O |
| Molecular Weight | 872.04 g/mol |
| Exact Mass | 871.33 |
| IUPAC Name | 3-[4-[4-(3,6-diphenylcarbazol-9-yl)-3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[3,2-b]pyridine |
| SMILES | C=C/C=C(\C=C)c1cc(-c2nc(-c3ccccc3)nc(-c3cnc4c(c3)oc3ccccc34)n2)cc(-c2ccccc2)c1-n1c2ccc(-c3ccccc3)cc2c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C62H41N5O/c1-3-19-40(4-2)50-36-47(61-64-60(44-26-15-8-16-27-44)65-62(66-61)48-38-57-58(63-39-48)49-28-17-18-29-56(49)68-57)37-51(43-24-13-7-14-25-43)59(50)67-54-32-30-45(41-20-9-5-10-21-41)34-52(54)53-35-46(31-33-55(53)67)42-22-11-6-12-23-42/h3-39H,1-2H2/b40-19+ |
| InChIKey | NANKHTQDAFSFCQ-XLDFTUSDSA-N |
| XLogP | 16.02 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.04 |
| LogP ≤ 5 | 16.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|