C58H39N3O — CID 168784432
4-[4-(3,6-diphenylcarbazol-9-yl)-3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-2-phenyl-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 168784432) has the molecular formula C58H39N3O and a molecular weight of 793.97 g/mol. Its IUPAC name is 4-[4-(3,6-diphenylcarbazol-9-yl)-3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-2-phenyl-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 4-[4-(3,6-diphenylcarbazol-9-yl)-3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-2-phenyl-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 168784432 |
| Molecular Formula | C58H39N3O |
| Molecular Weight | 793.97 g/mol |
| Exact Mass | 793.31 |
| IUPAC Name | 4-[4-(3,6-diphenylcarbazol-9-yl)-3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-2-phenyl-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | C=C/C=C(\C=C)c1cc(-c2nc(-c3ccccc3)nc3c2oc2ccccc23)cc(-c2ccccc2)c1-n1c2ccc(-c3ccccc3)cc2c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C58H39N3O/c1-3-19-38(4-2)47-36-45(54-57-55(46-28-17-18-29-53(46)62-57)60-58(59-54)42-26-15-8-16-27-42)37-48(41-24-13-7-14-25-41)56(47)61-51-32-30-43(39-20-9-5-10-21-39)34-49(51)50-35-44(31-33-52(50)61)40-22-11-6-12-23-40/h3-37H,1-2H2/b38-19+ |
| InChIKey | JBNDPLDBGSCIJV-OEPDXVHDSA-N |
| XLogP | 15.56 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.97 |
| LogP ≤ 5 | 15.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|