C63H43N5 — CID 168784060
2-carbazol-9-yl-9-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-6-phenylcarbazole (PubChem CID 168784060) has the molecular formula C63H43N5 and a molecular weight of 870.07 g/mol. Its IUPAC name is 2-carbazol-9-yl-9-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-6-phenylcarbazole.
| Compound Name | 2-carbazol-9-yl-9-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-6-phenylcarbazole |
|---|---|
| PubChem CID | 168784060 |
| Molecular Formula | C63H43N5 |
| Molecular Weight | 870.07 g/mol |
| Exact Mass | 869.35 |
| IUPAC Name | 2-carbazol-9-yl-9-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-6-phenylcarbazole |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)nc(-c2cc(-c3ccccc3)c(-n3c4ccc(-c5ccccc5)cc4c4ccc(-n5c6ccccc6c6ccccc65)cc43)c(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C63H43N5/c1-3-21-42(4-2)61-64-62(46-28-15-8-16-29-46)66-63(65-61)48-39-53(44-24-11-6-12-25-44)60(54(40-48)45-26-13-7-14-27-45)68-58-37-34-47(43-22-9-5-10-23-43)38-55(58)52-36-35-49(41-59(52)68)67-56-32-19-17-30-50(56)51-31-18-20-33-57(51)67/h3-41H,1-2H2/b42-21+ |
| InChIKey | HXAUOTJLJUBDON-BKPOFFDFSA-N |
| XLogP | 16.16 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.07 |
| LogP ≤ 5 | 16.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|