C58H40N4 — CID 167057871
11-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyrimidin-2-yl]-2,6-diphenylphenyl]-5-phenylindolo[3,2-b]carbazole (PubChem CID 167057871) has the molecular formula C58H40N4 and a molecular weight of 792.99 g/mol. Its IUPAC name is 11-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyrimidin-2-yl]-2,6-diphenylphenyl]-5-phenylindolo[3,2-b]carbazole.
| Compound Name | 11-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyrimidin-2-yl]-2,6-diphenylphenyl]-5-phenylindolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 167057871 |
| Molecular Formula | C58H40N4 |
| Molecular Weight | 792.99 g/mol |
| Exact Mass | 792.33 |
| IUPAC Name | 11-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyrimidin-2-yl]-2,6-diphenylphenyl]-5-phenylindolo[3,2-b]carbazole |
| SMILES | C=C/C=C(\C=C)c1cc(-c2ccccc2)nc(-c2cc(-c3ccccc3)c(-n3c4ccccc4c4cc5c(cc43)c3ccccc3n5-c3ccccc3)c(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C58H40N4/c1-3-21-39(4-2)51-38-52(42-26-13-7-14-27-42)60-58(59-51)43-34-47(40-22-9-5-10-23-40)57(48(35-43)41-24-11-6-12-25-41)62-54-33-20-18-31-46(54)50-36-55-49(37-56(50)62)45-30-17-19-32-53(45)61(55)44-28-15-8-16-29-44/h3-38H,1-2H2/b39-21+ |
| InChIKey | JQVDWTVIFVPRTL-LALXJTNGSA-N |
| XLogP | 15.09 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.99 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|