C35H28BN3O2 — CID 145148628
[9-[3-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-phenylpyrimidin-2-yl]phenyl]carbazol-3-yl]boronic acid (PubChem CID 145148628) has the molecular formula C35H28BN3O2 and a molecular weight of 533.44 g/mol. Its IUPAC name is [9-[3-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-phenylpyrimidin-2-yl]phenyl]carbazol-3-yl]boronic acid.
| Compound Name | [9-[3-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-phenylpyrimidin-2-yl]phenyl]carbazol-3-yl]boronic acid |
|---|---|
| PubChem CID | 145148628 |
| Molecular Formula | C35H28BN3O2 |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | [9-[3-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-phenylpyrimidin-2-yl]phenyl]carbazol-3-yl]boronic acid |
| SMILES | C=C/C(=C\C=C/C)c1cc(-c2ccccc2)nc(-c2cccc(-n3c4ccccc4c4cc(B(O)O)ccc43)c2)n1 |
| InChI | InChI=1S/C35H28BN3O2/c1-3-5-12-24(4-2)31-23-32(25-13-7-6-8-14-25)38-35(37-31)26-15-11-16-28(21-26)39-33-18-10-9-17-29(33)30-22-27(36(40)41)19-20-34(30)39/h3-23,40-41H,2H2,1H3/b5-3-,24-12+ |
| InChIKey | HPQDAHKASQJHMD-QOFJNMMKSA-N |
| XLogP | 6.73 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|