C54H39N3 — CID 144976611
9-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-3-[(1E)-1-(2-methyl-1-phenylindol-3-yl)buta-1,3-dien-2-yl]carbazole (PubChem CID 144976611) has the molecular formula C54H39N3 and a molecular weight of 729.93 g/mol. Its IUPAC name is 9-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-3-[(1E)-1-(2-methyl-1-phenylindol-3-yl)buta-1,3-dien-2-yl]carbazole.
| Compound Name | 9-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-3-[(1E)-1-(2-methyl-1-phenylindol-3-yl)buta-1,3-dien-2-yl]carbazole |
|---|---|
| PubChem CID | 144976611 |
| Molecular Formula | C54H39N3 |
| Molecular Weight | 729.93 g/mol |
| Exact Mass | 729.31 |
| IUPAC Name | 9-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-3-[(1E)-1-(2-methyl-1-phenylindol-3-yl)buta-1,3-dien-2-yl]carbazole |
| SMILES | C=C/C(=C\c1c(C)n(-c2ccccc2)c2ccccc12)c1ccc2c(c1)c1ccccc1n2-c1cccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C54H39N3/c1-3-38(33-48-37(2)56(44-23-11-6-12-24-44)52-28-15-13-26-46(48)52)42-30-31-54-49(34-42)47-27-14-16-29-53(47)57(54)45-25-17-22-41(32-45)43-35-50(39-18-7-4-8-19-39)55-51(36-43)40-20-9-5-10-21-40/h3-36H,1H2,2H3/b38-33+ |
| InChIKey | UEGSTPMKIKJYME-NNIBMBRCSA-N |
| XLogP | 14.16 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.93 |
| LogP ≤ 5 | 14.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|