C53H41N5 — CID 142521171
3-[(1E)-1-[5-[(1Z)-buta-1,3-dienyl]-1-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,4-dimethylpyrrol-2-yl]buta-1,3-dien-2-yl]-9-phenylcarbazole (PubChem CID 142521171) has the molecular formula C53H41N5 and a molecular weight of 747.95 g/mol. Its IUPAC name is 3-[(1E)-1-[5-[(1Z)-buta-1,3-dienyl]-1-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,4-dimethylpyrrol-2-yl]buta-1,3-dien-2-yl]-9-phenylcarbazole.
| Compound Name | 3-[(1E)-1-[5-[(1Z)-buta-1,3-dienyl]-1-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,4-dimethylpyrrol-2-yl]buta-1,3-dien-2-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 142521171 |
| Molecular Formula | C53H41N5 |
| Molecular Weight | 747.95 g/mol |
| Exact Mass | 747.34 |
| IUPAC Name | 3-[(1E)-1-[5-[(1Z)-buta-1,3-dienyl]-1-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,4-dimethylpyrrol-2-yl]buta-1,3-dien-2-yl]-9-phenylcarbazole |
| SMILES | C=C/C=C\c1c(C)c(C)c(/C=C(\C=C)c2ccc3c(c2)c2ccccc2n3-c2ccccc2)n1-c1cccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C53H41N5/c1-5-7-29-47-36(3)37(4)50(35-38(6-2)41-31-32-49-46(34-41)45-28-17-18-30-48(45)57(49)43-25-15-10-16-26-43)58(47)44-27-19-24-42(33-44)53-55-51(39-20-11-8-12-21-39)54-52(56-53)40-22-13-9-14-23-40/h5-35H,1-2H2,3-4H3/b29-7-,38-35+ |
| InChIKey | ZWWCMUQHLCDFHK-VLHJCRECSA-N |
| XLogP | 13.30 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.95 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|