C52H38N6 — CID 142308601
12-[4-[3-[2-[(1Z)-buta-1,3-dienyl]-3-methylindol-1-yl]phenyl]-6-[(3E)-hexa-1,3,5-trien-3-yl]-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole (PubChem CID 142308601) has the molecular formula C52H38N6 and a molecular weight of 746.92 g/mol. Its IUPAC name is 12-[4-[3-[2-[(1Z)-buta-1,3-dienyl]-3-methylindol-1-yl]phenyl]-6-[(3E)-hexa-1,3,5-trien-3-yl]-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole.
| Compound Name | 12-[4-[3-[2-[(1Z)-buta-1,3-dienyl]-3-methylindol-1-yl]phenyl]-6-[(3E)-hexa-1,3,5-trien-3-yl]-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 142308601 |
| Molecular Formula | C52H38N6 |
| Molecular Weight | 746.92 g/mol |
| Exact Mass | 746.32 |
| IUPAC Name | 12-[4-[3-[2-[(1Z)-buta-1,3-dienyl]-3-methylindol-1-yl]phenyl]-6-[(3E)-hexa-1,3,5-trien-3-yl]-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole |
| SMILES | C=C/C=C\c1c(C)c2ccccc2n1-c1cccc(-c2nc(/C(C=C)=C/C=C)nc(-n3c4ccccc4c4ccc5c6ccccc6n(-c6ccccc6)c5c43)n2)c1 |
| InChI | InChI=1S/C52H38N6/c1-5-8-27-44-34(4)39-24-12-15-28-45(39)56(44)38-23-18-20-36(33-38)51-53-50(35(7-3)19-6-2)54-52(55-51)58-47-30-17-14-26-41(47)43-32-31-42-40-25-13-16-29-46(40)57(48(42)49(43)58)37-21-10-9-11-22-37/h5-33H,1-3H2,4H3/b27-8-,35-19+ |
| InChIKey | FJTHTLSSDMMSRN-IQZASAHYSA-N |
| XLogP | 12.94 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.92 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|