C28H22N4 — CID 144884391
9-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-2-methylcarbazole (PubChem CID 144884391) has the molecular formula C28H22N4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 9-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-2-methylcarbazole.
| Compound Name | 9-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-2-methylcarbazole |
|---|---|
| PubChem CID | 144884391 |
| Molecular Formula | C28H22N4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 9-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-2-methylcarbazole |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)nc(-n2c3ccccc3c3ccc(C)cc32)n1 |
| InChI | InChI=1S/C28H22N4/c1-4-11-20(5-2)26-29-27(21-12-7-6-8-13-21)31-28(30-26)32-24-15-10-9-14-22(24)23-17-16-19(3)18-25(23)32/h4-18H,1-2H2,3H3/b20-11+ |
| InChIKey | QWBGMFGJANPEBD-RGVLZGJSSA-N |
| XLogP | 6.70 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|