C31H24N4 — CID 144734563
4-[3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-3-methylisoquinoline (PubChem CID 144734563) has the molecular formula C31H24N4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 4-[3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-3-methylisoquinoline.
| Compound Name | 4-[3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-3-methylisoquinoline |
|---|---|
| PubChem CID | 144734563 |
| Molecular Formula | C31H24N4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 4-[3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-3-methylisoquinoline |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)nc(-c2cccc(-c3c(C)ncc4ccccc34)c2)n1 |
| InChI | InChI=1S/C31H24N4/c1-4-12-22(5-2)29-33-30(23-13-7-6-8-14-23)35-31(34-29)25-17-11-16-24(19-25)28-21(3)32-20-26-15-9-10-18-27(26)28/h4-20H,1-2H2,3H3/b22-12+ |
| InChIKey | MDJGWRWNWRMPRT-WSDLNYQXSA-N |
| XLogP | 7.48 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|