C27H22N4 — CID 144734447
2-[(3E)-hexa-1,3,5-trien-3-yl]-4-[3-(6-methyl-3-pyridinyl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 144734447) has the molecular formula C27H22N4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-4-[3-(6-methyl-3-pyridinyl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-4-[3-(6-methyl-3-pyridinyl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 144734447 |
| Molecular Formula | C27H22N4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-4-[3-(6-methyl-3-pyridinyl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)nc(-c2cccc(-c3ccc(C)nc3)c2)n1 |
| InChI | InChI=1S/C27H22N4/c1-4-10-20(5-2)25-29-26(21-11-7-6-8-12-21)31-27(30-25)23-14-9-13-22(17-23)24-16-15-19(3)28-18-24/h4-18H,1-2H2,3H3/b20-10+ |
| InChIKey | QDYMDSOQYAMFDC-KEBDBYFISA-N |
| XLogP | 6.33 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|