C37H28N4 — CID 144734375
4-[4-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]-3-methylisoquinoline (PubChem CID 144734375) has the molecular formula C37H28N4 and a molecular weight of 528.66 g/mol. Its IUPAC name is 4-[4-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]-3-methylisoquinoline.
| Compound Name | 4-[4-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]-3-methylisoquinoline |
|---|---|
| PubChem CID | 144734375 |
| Molecular Formula | C37H28N4 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 4-[4-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]-3-methylisoquinoline |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)nc(-c2ccc(-c3ccc(-c4c(C)ncc5ccccc45)cc3)cc2)n1 |
| InChI | InChI=1S/C37H28N4/c1-4-11-26(5-2)35-39-36(30-12-7-6-8-13-30)41-37(40-35)31-22-18-28(19-23-31)27-16-20-29(21-17-27)34-25(3)38-24-32-14-9-10-15-33(32)34/h4-24H,1-2H2,3H3/b26-11+ |
| InChIKey | SJRVTXPQKDCQRF-KBKYJPHKSA-N |
| XLogP | 9.15 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|