C27H20ClN3 — CID 135264971
2-[4-(4-chlorophenyl)phenyl]-4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazine (PubChem CID 135264971) has the molecular formula C27H20ClN3 and a molecular weight of 421.93 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)phenyl]-4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[4-(4-chlorophenyl)phenyl]-4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 135264971 |
| Molecular Formula | C27H20ClN3 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-[4-(4-chlorophenyl)phenyl]-4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)nc(-c2ccc(-c3ccc(Cl)cc3)cc2)n1 |
| InChI | InChI=1S/C27H20ClN3/c1-3-8-19(4-2)25-29-26(22-9-6-5-7-10-22)31-27(30-25)23-13-11-20(12-14-23)21-15-17-24(28)18-16-21/h3-18H,1-2H2/b19-8+ |
| InChIKey | OEXNQBMBJXSQIA-UFWORHAWSA-N |
| XLogP | 7.28 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|