C15H14N3O3P — CID 142351616
[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phosphonic acid (PubChem CID 142351616) has the molecular formula C15H14N3O3P and a molecular weight of 315.27 g/mol. Its IUPAC name is [4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phosphonic acid.
| Compound Name | [4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 142351616 |
| Molecular Formula | C15H14N3O3P |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | [4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phosphonic acid |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)nc(P(=O)(O)O)n1 |
| InChI | InChI=1S/C15H14N3O3P/c1-3-8-11(4-2)13-16-14(12-9-6-5-7-10-12)18-15(17-13)22(19,20)21/h3-10H,1-2H2,(H2,19,20,21)/b11-8+ |
| InChIKey | GVXDXTOKKOWAKJ-DHZHZOJOSA-N |
| XLogP | 2.10 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|