C15H12N3O3P — CID 134535663
(4,6-diphenyl-1,3,5-triazin-2-yl)phosphonic acid (PubChem CID 134535663) has the molecular formula C15H12N3O3P and a molecular weight of 313.25 g/mol. Its IUPAC name is (4,6-diphenyl-1,3,5-triazin-2-yl)phosphonic acid.
| Compound Name | (4,6-diphenyl-1,3,5-triazin-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 134535663 |
| Molecular Formula | C15H12N3O3P |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (4,6-diphenyl-1,3,5-triazin-2-yl)phosphonic acid |
| SMILES | O=P(O)(O)c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H12N3O3P/c19-22(20,21)15-17-13(11-7-3-1-4-8-11)16-14(18-15)12-9-5-2-6-10-12/h1-10H,(H2,19,20,21) |
| InChIKey | DOMRNCGICNNSIP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|