C28H23N4OP — CID 163411287
4-[4-diphenylphosphoryl-6-(4-methylphenyl)-1,3,5-triazin-2-yl]aniline (PubChem CID 163411287) has the molecular formula C28H23N4OP and a molecular weight of 462.49 g/mol. Its IUPAC name is 4-[4-diphenylphosphoryl-6-(4-methylphenyl)-1,3,5-triazin-2-yl]aniline.
| Compound Name | 4-[4-diphenylphosphoryl-6-(4-methylphenyl)-1,3,5-triazin-2-yl]aniline |
|---|---|
| PubChem CID | 163411287 |
| Molecular Formula | C28H23N4OP |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 4-[4-diphenylphosphoryl-6-(4-methylphenyl)-1,3,5-triazin-2-yl]aniline |
| SMILES | Cc1ccc(-c2nc(-c3ccc(N)cc3)nc(P(=O)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C28H23N4OP/c1-20-12-14-21(15-13-20)26-30-27(22-16-18-23(29)19-17-22)32-28(31-26)34(33,24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2-19H,29H2,1H3 |
| InChIKey | AASNRUDPMOOAOZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|