C28H23N4O3P — CID 163481572
4-[[4-diphenylphosphoryl-6-(4-methylphenoxy)-1,3,5-triazin-2-yl]oxy]aniline (PubChem CID 163481572) has the molecular formula C28H23N4O3P and a molecular weight of 494.49 g/mol. Its IUPAC name is 4-[[4-diphenylphosphoryl-6-(4-methylphenoxy)-1,3,5-triazin-2-yl]oxy]aniline.
| Compound Name | 4-[[4-diphenylphosphoryl-6-(4-methylphenoxy)-1,3,5-triazin-2-yl]oxy]aniline |
|---|---|
| PubChem CID | 163481572 |
| Molecular Formula | C28H23N4O3P |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 4-[[4-diphenylphosphoryl-6-(4-methylphenoxy)-1,3,5-triazin-2-yl]oxy]aniline |
| SMILES | Cc1ccc(Oc2nc(Oc3ccc(N)cc3)nc(P(=O)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C28H23N4O3P/c1-20-12-16-22(17-13-20)34-26-30-27(35-23-18-14-21(29)15-19-23)32-28(31-26)36(33,24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2-19H,29H2,1H3 |
| InChIKey | CEZMZPJAINSMSU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 100.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|