C12H13N3O3 — CID 113292982
4-(4,6-dimethoxypyrimidin-2-yl)oxyaniline (PubChem CID 113292982) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-(4,6-dimethoxypyrimidin-2-yl)oxyaniline.
| Compound Name | 4-(4,6-dimethoxypyrimidin-2-yl)oxyaniline |
|---|---|
| PubChem CID | 113292982 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 4-(4,6-dimethoxypyrimidin-2-yl)oxyaniline |
| SMILES | COc1cc(OC)nc(Oc2ccc(N)cc2)n1 |
| InChI | InChI=1S/C12H13N3O3/c1-16-10-7-11(17-2)15-12(14-10)18-9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3 |
| InChIKey | DMEAJNCWVMSSBH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|