C18H19N5O6 — CID 134106660
2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]aniline (PubChem CID 134106660) has the molecular formula C18H19N5O6 and a molecular weight of 401.38 g/mol. Its IUPAC name is 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]aniline.
| Compound Name | 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]aniline |
|---|---|
| PubChem CID | 134106660 |
| Molecular Formula | C18H19N5O6 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]aniline |
| SMILES | COc1cc(OC)nc(Oc2cccc(Oc3nc(OC)cc(OC)n3)c2N)n1 |
| InChI | InChI=1S/C18H19N5O6/c1-24-12-8-13(25-2)21-17(20-12)28-10-6-5-7-11(16(10)19)29-18-22-14(26-3)9-15(23-18)27-4/h5-9H,19H2,1-4H3 |
| InChIKey | MHAVJCQTLDIUTN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|