C23H26N4O9 — CID 141043320
2-[2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]ethyl ethyl carbonate (PubChem CID 141043320) has the molecular formula C23H26N4O9 and a molecular weight of 502.48 g/mol. Its IUPAC name is 2-[2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]ethyl ethyl carbonate.
| Compound Name | 2-[2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]ethyl ethyl carbonate |
|---|---|
| PubChem CID | 141043320 |
| Molecular Formula | C23H26N4O9 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 2-[2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]ethyl ethyl carbonate |
| SMILES | CCOC(=O)OCCc1c(Oc2nc(OC)cc(OC)n2)cccc1Oc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C23H26N4O9/c1-6-33-23(28)34-11-10-14-15(35-21-24-17(29-2)12-18(25-21)30-3)8-7-9-16(14)36-22-26-19(31-4)13-20(27-22)32-5/h7-9,12-13H,6,10-11H2,1-5H3 |
| InChIKey | YJNYLINHVUEJLK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 142.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |