C18H22N2O5 — CID 67737510
2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-pentylbenzoic acid (PubChem CID 67737510) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-pentylbenzoic acid.
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 67737510 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-pentylbenzoic acid |
| SMILES | CCCCCc1cccc(Oc2nc(OC)cc(OC)n2)c1C(=O)O |
| InChI | InChI=1S/C18H22N2O5/c1-4-5-6-8-12-9-7-10-13(16(12)17(21)22)25-18-19-14(23-2)11-15(20-18)24-3/h7,9-11H,4-6,8H2,1-3H3,(H,21,22) |
| InChIKey | FYKDIHYINFYBJG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|