2,4-dimethoxy-6-pentylbenzoic acid

C14H20O4 — CID 12658769

IUPAC2,4-dimethoxy-6-pentylbenzoic acid
SMILESCCCCCc1cc(OC)cc(OC)c1C(=O)O
InChIInChI=1S/C14H20O4/c1-4-5-6-7-10-8-11(17-2)9-12(18-3)13(10)14(15)16/h8-9H,4-7H2,1-3H3,(H,15,16)
InChIKeyZGQDKQGOSJZNGR-UHFFFAOYSA-N
MW252.31 g/mol
LogP3.13
Rot. Bonds7

About 2,4-dimethoxy-6-pentylbenzoic acid

2,4-dimethoxy-6-pentylbenzoic acid (PubChem CID 12658769) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2,4-dimethoxy-6-pentylbenzoic acid.

Molecular Properties

Compound Name2,4-dimethoxy-6-pentylbenzoic acid
PubChem CID12658769
Molecular FormulaC14H20O4
Molecular Weight252.31 g/mol
Exact Mass252.14
IUPAC Name2,4-dimethoxy-6-pentylbenzoic acid
SMILESCCCCCc1cc(OC)cc(OC)c1C(=O)O
InChIInChI=1S/C14H20O4/c1-4-5-6-7-10-8-11(17-2)9-12(18-3)13(10)14(15)16/h8-9H,4-7H2,1-3H3,(H,15,16)
InChIKeyZGQDKQGOSJZNGR-UHFFFAOYSA-N
XLogP3.13
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.31
LogP ≤ 53.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,4-dimethoxy-6-pentylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dimethoxy-6-pentylbenzoic acid?
The IUPAC name of 2,4-dimethoxy-6-pentylbenzoic acid (CID 12658769) is 2,4-dimethoxy-6-pentylbenzoic acid.
What is the SMILES notation for 2,4-dimethoxy-6-pentylbenzoic acid?
The canonical SMILES for 2,4-dimethoxy-6-pentylbenzoic acid is CCCCCc1cc(OC)cc(OC)c1C(=O)O.
What is the InChIKey of 2,4-dimethoxy-6-pentylbenzoic acid?
The InChIKey is ZGQDKQGOSJZNGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-4-5-6-7-10-8-11(17-2)9-12(18-3)13(10)14(15)16/h8-9H,4-7H2,1-3H3,(H,15,16).
What are the key properties of 2,4-dimethoxy-6-pentylbenzoic acid?
2,4-dimethoxy-6-pentylbenzoic acid has a molecular weight of 252.31 g/mol, XLogP of 3.13, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethoxy-6-pentylbenzoic acid is sourced from PubChem (CID 12658769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).