C14H22O2S — CID 156744288
1,5-dimethoxy-2-methylsulfanyl-3-pentylbenzene (PubChem CID 156744288) has the molecular formula C14H22O2S and a molecular weight of 254.39 g/mol. Its IUPAC name is 1,5-dimethoxy-2-methylsulfanyl-3-pentylbenzene.
| Compound Name | 1,5-dimethoxy-2-methylsulfanyl-3-pentylbenzene |
|---|---|
| PubChem CID | 156744288 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1,5-dimethoxy-2-methylsulfanyl-3-pentylbenzene |
| SMILES | CCCCCc1cc(OC)cc(OC)c1SC |
| InChI | InChI=1S/C14H22O2S/c1-5-6-7-8-11-9-12(15-2)10-13(16-3)14(11)17-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | IYZYONWPWGDPCJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|