C17H27NO3 — CID 86164475
2-butyl-N,N-diethyl-4,6-dimethoxybenzamide (PubChem CID 86164475) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-butyl-N,N-diethyl-4,6-dimethoxybenzamide.
| Compound Name | 2-butyl-N,N-diethyl-4,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 86164475 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 2-butyl-N,N-diethyl-4,6-dimethoxybenzamide |
| SMILES | CCCCc1cc(OC)cc(OC)c1C(=O)N(CC)CC |
| InChI | InChI=1S/C17H27NO3/c1-6-9-10-13-11-14(20-4)12-15(21-5)16(13)17(19)18(7-2)8-3/h11-12H,6-10H2,1-5H3 |
| InChIKey | APZCDNJMGVYRSK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |