C19H23NO4 — CID 110764638
N-benzyl-N-ethyl-2,4,6-trimethoxybenzamide (PubChem CID 110764638) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2,4,6-trimethoxybenzamide.
| Compound Name | N-benzyl-N-ethyl-2,4,6-trimethoxybenzamide |
|---|---|
| PubChem CID | 110764638 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-benzyl-N-ethyl-2,4,6-trimethoxybenzamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C19H23NO4/c1-5-20(13-14-9-7-6-8-10-14)19(21)18-16(23-3)11-15(22-2)12-17(18)24-4/h6-12H,5,13H2,1-4H3 |
| InChIKey | NPWJYKOUJSCCFB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |