C20H26N2O3 — CID 109022967
N-benzyl-3-(2,4-dimethoxyanilino)-N-ethylpropanamide (PubChem CID 109022967) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-benzyl-3-(2,4-dimethoxyanilino)-N-ethylpropanamide.
| Compound Name | N-benzyl-3-(2,4-dimethoxyanilino)-N-ethylpropanamide |
|---|---|
| PubChem CID | 109022967 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-benzyl-3-(2,4-dimethoxyanilino)-N-ethylpropanamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CCNc1ccc(OC)cc1OC |
| InChI | InChI=1S/C20H26N2O3/c1-4-22(15-16-8-6-5-7-9-16)20(23)12-13-21-18-11-10-17(24-2)14-19(18)25-3/h5-11,14,21H,4,12-13,15H2,1-3H3 |
| InChIKey | ZRHJKSFZOJKLDL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|