C18H19F3N2O — CID 109023020
N-benzyl-N-ethyl-3-(2,3,4-trifluoroanilino)propanamide (PubChem CID 109023020) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is N-benzyl-N-ethyl-3-(2,3,4-trifluoroanilino)propanamide.
| Compound Name | N-benzyl-N-ethyl-3-(2,3,4-trifluoroanilino)propanamide |
|---|---|
| PubChem CID | 109023020 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-benzyl-N-ethyl-3-(2,3,4-trifluoroanilino)propanamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CCNc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H19F3N2O/c1-2-23(12-13-6-4-3-5-7-13)16(24)10-11-22-15-9-8-14(19)17(20)18(15)21/h3-9,22H,2,10-12H2,1H3 |
| InChIKey | JHACSBJKYCXFHT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|