C21H26N2O2 — CID 2392254
N,N'-dibenzyl-N,N'-diethylpropanediamide (PubChem CID 2392254) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N,N'-dibenzyl-N,N'-diethylpropanediamide.
| Compound Name | N,N'-dibenzyl-N,N'-diethylpropanediamide |
|---|---|
| PubChem CID | 2392254 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N,N'-dibenzyl-N,N'-diethylpropanediamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CC(=O)N(CC)Cc1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c1-3-22(16-18-11-7-5-8-12-18)20(24)15-21(25)23(4-2)17-19-13-9-6-10-14-19/h5-14H,3-4,15-17H2,1-2H3 |
| InChIKey | UXXQBWCUGQPVDT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|