C23H30N2O2 — CID 68902262
N,N'-dibenzyl-N,N'-diethylpentanediamide (PubChem CID 68902262) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is N,N'-dibenzyl-N,N'-diethylpentanediamide.
| Compound Name | N,N'-dibenzyl-N,N'-diethylpentanediamide |
|---|---|
| PubChem CID | 68902262 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N,N'-dibenzyl-N,N'-diethylpentanediamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CCCC(=O)N(CC)Cc1ccccc1 |
| InChI | InChI=1S/C23H30N2O2/c1-3-24(18-20-12-7-5-8-13-20)22(26)16-11-17-23(27)25(4-2)19-21-14-9-6-10-15-21/h5-10,12-15H,3-4,11,16-19H2,1-2H3 |
| InChIKey | FKAWYWMVRZSVFR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |