C21H29NOSi — CID 16744462
N,N-dibenzyl-4-trimethylsilylbutanamide (PubChem CID 16744462) has the molecular formula C21H29NOSi and a molecular weight of 339.56 g/mol. Its IUPAC name is N,N-dibenzyl-4-trimethylsilylbutanamide.
| Compound Name | N,N-dibenzyl-4-trimethylsilylbutanamide |
|---|---|
| PubChem CID | 16744462 |
| Molecular Formula | C21H29NOSi |
| Molecular Weight | 339.56 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | N,N-dibenzyl-4-trimethylsilylbutanamide |
| SMILES | C[Si](C)(C)CCCC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H29NOSi/c1-24(2,3)16-10-15-21(23)22(17-19-11-6-4-7-12-19)18-20-13-8-5-9-14-20/h4-9,11-14H,10,15-18H2,1-3H3 |
| InChIKey | WQWBYZBVSVFFQV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|