C26H34N4O4 — CID 28642999
N,N'-bis(3-amino-3-oxopropyl)-N,N'-dibenzylhexanediamide (PubChem CID 28642999) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is N,N'-bis(3-amino-3-oxopropyl)-N,N'-dibenzylhexanediamide.
| Compound Name | N,N'-bis(3-amino-3-oxopropyl)-N,N'-dibenzylhexanediamide |
|---|---|
| PubChem CID | 28642999 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | N,N'-bis(3-amino-3-oxopropyl)-N,N'-dibenzylhexanediamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)C(=O)CCCCC(=O)N(CCC(N)=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H34N4O4/c27-23(31)15-17-29(19-21-9-3-1-4-10-21)25(33)13-7-8-14-26(34)30(18-16-24(28)32)20-22-11-5-2-6-12-22/h1-6,9-12H,7-8,13-20H2,(H2,27,31)(H2,28,32) |
| InChIKey | BSIAVCZJQIUKPP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|