C12H13Cl3N2O2 — CID 154136275
3-[benzyl-(2,2,2-trichloroacetyl)amino]propanamide (PubChem CID 154136275) has the molecular formula C12H13Cl3N2O2 and a molecular weight of 323.61 g/mol. Its IUPAC name is 3-[benzyl-(2,2,2-trichloroacetyl)amino]propanamide.
| Compound Name | 3-[benzyl-(2,2,2-trichloroacetyl)amino]propanamide |
|---|---|
| PubChem CID | 154136275 |
| Molecular Formula | C12H13Cl3N2O2 |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 3-[benzyl-(2,2,2-trichloroacetyl)amino]propanamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13Cl3N2O2/c13-12(14,15)11(19)17(7-6-10(16)18)8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H2,16,18) |
| InChIKey | AETQPFGDQMISHC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|