C17H16Cl2N2O2 — CID 28642575
N-(3-amino-3-oxopropyl)-N-benzyl-3,5-dichlorobenzamide (PubChem CID 28642575) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-N-benzyl-3,5-dichlorobenzamide.
| Compound Name | N-(3-amino-3-oxopropyl)-N-benzyl-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 28642575 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-N-benzyl-3,5-dichlorobenzamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O2/c18-14-8-13(9-15(19)10-14)17(23)21(7-6-16(20)22)11-12-4-2-1-3-5-12/h1-5,8-10H,6-7,11H2,(H2,20,22) |
| InChIKey | IFDOEEUWVMKCBR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |