C18H17Cl2N3O2S — CID 28642848
N-[(3-amino-3-oxopropyl)-benzylcarbamothioyl]-3,5-dichlorobenzamide (PubChem CID 28642848) has the molecular formula C18H17Cl2N3O2S and a molecular weight of 410.33 g/mol. Its IUPAC name is N-[(3-amino-3-oxopropyl)-benzylcarbamothioyl]-3,5-dichlorobenzamide.
| Compound Name | N-[(3-amino-3-oxopropyl)-benzylcarbamothioyl]-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 28642848 |
| Molecular Formula | C18H17Cl2N3O2S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | N-[(3-amino-3-oxopropyl)-benzylcarbamothioyl]-3,5-dichlorobenzamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)C(=S)NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N3O2S/c19-14-8-13(9-15(20)10-14)17(25)22-18(26)23(7-6-16(21)24)11-12-4-2-1-3-5-12/h1-5,8-10H,6-7,11H2,(H2,21,24)(H,22,25,26) |
| InChIKey | OVYSSPNUPBINQV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|