C20H18ClN3O2S2 — CID 28642755
N-[(3-amino-3-oxopropyl)-benzylcarbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 28642755) has the molecular formula C20H18ClN3O2S2 and a molecular weight of 431.97 g/mol. Its IUPAC name is N-[(3-amino-3-oxopropyl)-benzylcarbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(3-amino-3-oxopropyl)-benzylcarbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 28642755 |
| Molecular Formula | C20H18ClN3O2S2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | N-[(3-amino-3-oxopropyl)-benzylcarbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)C(=S)NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C20H18ClN3O2S2/c21-17-14-8-4-5-9-15(14)28-18(17)19(26)23-20(27)24(11-10-16(22)25)12-13-6-2-1-3-7-13/h1-9H,10-12H2,(H2,22,25)(H,23,26,27) |
| InChIKey | WOTNZCDPXBRFFX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|