C13H12ClNO2S2 — CID 2227579
O-propyl N-(3-chloro-1-benzothiophene-2-carbonyl)carbamothioate (PubChem CID 2227579) has the molecular formula C13H12ClNO2S2 and a molecular weight of 313.83 g/mol. Its IUPAC name is O-propyl N-(3-chloro-1-benzothiophene-2-carbonyl)carbamothioate.
| Compound Name | O-propyl N-(3-chloro-1-benzothiophene-2-carbonyl)carbamothioate |
|---|---|
| PubChem CID | 2227579 |
| Molecular Formula | C13H12ClNO2S2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | O-propyl N-(3-chloro-1-benzothiophene-2-carbonyl)carbamothioate |
| SMILES | CCCOC(=S)NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C13H12ClNO2S2/c1-2-7-17-13(18)15-12(16)11-10(14)8-5-3-4-6-9(8)19-11/h3-6H,2,7H2,1H3,(H,15,16,18) |
| InChIKey | MQXGDOLOVNTENR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|