C18H16ClN3O3S3 — CID 6262932
ethyl (2Z)-2-[(3-chloro-1-benzothiophene-2-carbonyl)carbamothioylimino]-3,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 6262932) has the molecular formula C18H16ClN3O3S3 and a molecular weight of 454.00 g/mol. Its IUPAC name is ethyl (2Z)-2-[(3-chloro-1-benzothiophene-2-carbonyl)carbamothioylimino]-3,4-dimethyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl (2Z)-2-[(3-chloro-1-benzothiophene-2-carbonyl)carbamothioylimino]-3,4-dimethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 6262932 |
| Molecular Formula | C18H16ClN3O3S3 |
| Molecular Weight | 454.00 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | ethyl (2Z)-2-[(3-chloro-1-benzothiophene-2-carbonyl)carbamothioylimino]-3,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1s/c(=N\C(=S)NC(=O)c2sc3ccccc3c2Cl)n(C)c1C |
| InChI | InChI=1S/C18H16ClN3O3S3/c1-4-25-16(24)13-9(2)22(3)18(28-13)21-17(26)20-15(23)14-12(19)10-7-5-6-8-11(10)27-14/h5-8H,4H2,1-3H3,(H,20,23,26)/b21-18- |
| InChIKey | JGKNZUOIESQWHH-UZYVYHOESA-N |
| XLogP | 4.06 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.00 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|