C10H14N2O3S — CID 5057306
ethyl 2-acetylimino-3,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 5057306) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is ethyl 2-acetylimino-3,4-dimethyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-acetylimino-3,4-dimethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 5057306 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | ethyl 2-acetylimino-3,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1s/c(=N\C(C)=O)n(C)c1C |
| InChI | InChI=1S/C10H14N2O3S/c1-5-15-9(14)8-6(2)12(4)10(16-8)11-7(3)13/h5H2,1-4H3/b11-10- |
| InChIKey | OGUNMCGTDYJSDD-KHPPLWFESA-N |
| XLogP | 1.02 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|