C20H24ClN3O5S2 — CID 16861913
ethyl 2-[1-(4-chlorophenyl)sulfonylpiperidine-3-carbonyl]imino-3,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 16861913) has the molecular formula C20H24ClN3O5S2 and a molecular weight of 486.02 g/mol. Its IUPAC name is ethyl 2-[1-(4-chlorophenyl)sulfonylpiperidine-3-carbonyl]imino-3,4-dimethyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[1-(4-chlorophenyl)sulfonylpiperidine-3-carbonyl]imino-3,4-dimethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 16861913 |
| Molecular Formula | C20H24ClN3O5S2 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | ethyl 2-[1-(4-chlorophenyl)sulfonylpiperidine-3-carbonyl]imino-3,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1s/c(=N/C(=O)C2CCCN(S(=O)(=O)c3ccc(Cl)cc3)C2)n(C)c1C |
| InChI | InChI=1S/C20H24ClN3O5S2/c1-4-29-19(26)17-13(2)23(3)20(30-17)22-18(25)14-6-5-11-24(12-14)31(27,28)16-9-7-15(21)8-10-16/h7-10,14H,4-6,11-12H2,1-3H3/b22-20+ |
| InChIKey | IZHVQRXSVBEMDV-LSDHQDQOSA-N |
| XLogP | 2.75 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|