About ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate
ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate (PubChem CID 14801951) has the molecular formula C9H10N2O2S
and a molecular weight of 210.26 g/mol. Its IUPAC name is ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate.
Analyze ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate?
The IUPAC name of ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate (CID 14801951) is ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate.
What is the SMILES notation for ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate?
The canonical SMILES for ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate is CCOC(=O)c1sc2nccn2c1C.
What is the InChIKey of ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate?
The InChIKey is LBBSFTFSJPJBTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2S/c1-3-13-8(12)7-6(2)11-5-4-10-9(11)14-7/h4-5H,3H2,1-2H3.
What are the key properties of ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate?
ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate has a molecular weight of 210.26 g/mol, XLogP of 1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate is sourced from PubChem (CID 14801951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).