About (3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine
(3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine (PubChem CID 82503049) has the molecular formula C7H9N3S
and a molecular weight of 167.24 g/mol. Its IUPAC name is (3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine.
Analyze (3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine?
The IUPAC name of (3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine (CID 82503049) is (3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine.
What is the SMILES notation for (3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine?
The canonical SMILES for (3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine is Cc1c(CN)sc2nccn12.
What is the InChIKey of (3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine?
The InChIKey is PLTQWYSIQNSBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S/c1-5-6(4-8)11-7-9-2-3-10(5)7/h2-3H,4,8H2,1H3.
What are the key properties of (3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine?
(3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine has a molecular weight of 167.24 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylimidazo[2,1-b][1,3]thiazol-2-yl)methanamine is sourced from PubChem (CID 82503049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).