C7H8N4S — CID 83875469
3-methylimidazo[2,1-b][1,3]thiazole-2-carboximidamide (PubChem CID 83875469) has the molecular formula C7H8N4S and a molecular weight of 180.24 g/mol. Its IUPAC name is 3-methylimidazo[2,1-b][1,3]thiazole-2-carboximidamide.
| Compound Name | 3-methylimidazo[2,1-b][1,3]thiazole-2-carboximidamide |
|---|---|
| PubChem CID | 83875469 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 3-methylimidazo[2,1-b][1,3]thiazole-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1sc2nccn2c1C |
| InChI | InChI=1S/C7H8N4S/c1-4-5(6(8)9)12-7-10-2-3-11(4)7/h2-3H,1H3,(H3,8,9) |
| InChIKey | JIWDTSWSYPHNSR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|